C9H12N2O2S — CID 871986
3-hydroxy-2,2-dimethyl-1-oxido-5-thiophen-2-yl-4H-imidazol-1-ium (PubChem CID 871986) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-1-oxido-5-thiophen-2-yl-4H-imidazol-1-ium.
| Compound Name | 3-hydroxy-2,2-dimethyl-1-oxido-5-thiophen-2-yl-4H-imidazol-1-ium |
|---|---|
| PubChem CID | 871986 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-1-oxido-5-thiophen-2-yl-4H-imidazol-1-ium |
| SMILES | CC1(C)N(O)CC(c2cccs2)=[N+]1[O-] |
| InChI | InChI=1S/C9H12N2O2S/c1-9(2)10(12)6-7(11(9)13)8-4-3-5-14-8/h3-5,12H,6H2,1-2H3 |
| InChIKey | BMUZILCLJSNCEM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|