C15H14N3O4S+ — CID 137052631
(2S)-1-hydroxy-2,4-dimethyl-2-(3-nitrophenyl)-3-oxido-5-thiophen-2-ylimidazole-1,3-diium (PubChem CID 137052631) has the molecular formula C15H14N3O4S+ and a molecular weight of 332.36 g/mol. Its IUPAC name is (2S)-1-hydroxy-2,4-dimethyl-2-(3-nitrophenyl)-3-oxido-5-thiophen-2-ylimidazole-1,3-diium.
| Compound Name | (2S)-1-hydroxy-2,4-dimethyl-2-(3-nitrophenyl)-3-oxido-5-thiophen-2-ylimidazole-1,3-diium |
|---|---|
| PubChem CID | 137052631 |
| Molecular Formula | C15H14N3O4S+ |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (2S)-1-hydroxy-2,4-dimethyl-2-(3-nitrophenyl)-3-oxido-5-thiophen-2-ylimidazole-1,3-diium |
| SMILES | CC1=[N+]([O-])[C@](C)(c2cccc([N+](=O)[O-])c2)[N+](O)=C1c1cccs1 |
| InChI | InChI=1S/C15H14N3O4S/c1-10-14(13-7-4-8-23-13)17(20)15(2,16(10)19)11-5-3-6-12(9-11)18(21)22/h3-9,20H,1-2H3/q+1/t15-/m0/s1 |
| InChIKey | ATECXHYTJNSHNU-HNNXBMFYSA-N |
| XLogP | 2.70 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|