C12H12OS — CID 24859406
6-methyl-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 24859406) has the molecular formula C12H12OS and a molecular weight of 204.29 g/mol. Its IUPAC name is 6-methyl-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 6-methyl-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 24859406 |
| Molecular Formula | C12H12OS |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 6-methyl-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC1CC(c2cccs2)=CC=C1C=O |
| InChI | InChI=1S/C12H12OS/c1-9-7-10(4-5-11(9)8-13)12-3-2-6-14-12/h2-6,8-9H,7H2,1H3 |
| InChIKey | ULZFTLZKGXVQGQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|