C26H26OS4 — CID 156598690
(2E,6E)-4-tert-butyl-2,6-bis(2-thiophen-2-ylthiophen-1-ylidene)cyclohexan-1-one (PubChem CID 156598690) has the molecular formula C26H26OS4 and a molecular weight of 482.76 g/mol. Its IUPAC name is (2E,6E)-4-tert-butyl-2,6-bis(2-thiophen-2-ylthiophen-1-ylidene)cyclohexan-1-one.
| Compound Name | (2E,6E)-4-tert-butyl-2,6-bis(2-thiophen-2-ylthiophen-1-ylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 156598690 |
| Molecular Formula | C26H26OS4 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (2E,6E)-4-tert-butyl-2,6-bis(2-thiophen-2-ylthiophen-1-ylidene)cyclohexan-1-one |
| SMILES | CC(C)(C)C1C/C(=S2/C=CC=C2c2cccs2)C(=O)/C(=S2\C=CC=C2c2cccs2)C1 |
| InChI | InChI=1S/C26H26OS4/c1-26(2,3)18-16-23(30-14-6-10-21(30)19-8-4-12-28-19)25(27)24(17-18)31-15-7-11-22(31)20-9-5-13-29-20/h4-15,18H,16-17H2,1-3H3 |
| InChIKey | PCAQDRFZNJSKKA-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|