C17H24N2OS — CID 66200785
5-(4-tert-butylcyclohexyl)-4-thiophen-2-yl-1,2-oxazol-3-amine (PubChem CID 66200785) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 5-(4-tert-butylcyclohexyl)-4-thiophen-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(4-tert-butylcyclohexyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200785 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 5-(4-tert-butylcyclohexyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
| SMILES | CC(C)(C)C1CCC(c2onc(N)c2-c2cccs2)CC1 |
| InChI | InChI=1S/C17H24N2OS/c1-17(2,3)12-8-6-11(7-9-12)15-14(16(18)19-20-15)13-5-4-10-21-13/h4-5,10-12H,6-9H2,1-3H3,(H2,18,19) |
| InChIKey | BMZXHCDYKZZREI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |