C18H20N2S2 — CID 84818674
7-tert-butyl-3-sulfanylidene-1-thiophen-2-yl-5,6,7,8-tetrahydro-2H-isoquinoline-4-carbonitrile (PubChem CID 84818674) has the molecular formula C18H20N2S2 and a molecular weight of 328.51 g/mol. Its IUPAC name is 7-tert-butyl-3-sulfanylidene-1-thiophen-2-yl-5,6,7,8-tetrahydro-2H-isoquinoline-4-carbonitrile.
| Compound Name | 7-tert-butyl-3-sulfanylidene-1-thiophen-2-yl-5,6,7,8-tetrahydro-2H-isoquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 84818674 |
| Molecular Formula | C18H20N2S2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 7-tert-butyl-3-sulfanylidene-1-thiophen-2-yl-5,6,7,8-tetrahydro-2H-isoquinoline-4-carbonitrile |
| SMILES | CC(C)(C)C1CCc2c(c(-c3cccs3)[nH]c(=S)c2C#N)C1 |
| InChI | InChI=1S/C18H20N2S2/c1-18(2,3)11-6-7-12-13(9-11)16(15-5-4-8-22-15)20-17(21)14(12)10-19/h4-5,8,11H,6-7,9H2,1-3H3,(H,20,21) |
| InChIKey | RICLIZAEENLJOH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|