C17H8N2OS2 — CID 10687171
5-oxo-2-sulfanylidene-4-thiophen-2-yl-1H-indeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 10687171) has the molecular formula C17H8N2OS2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-oxo-2-sulfanylidene-4-thiophen-2-yl-1H-indeno[1,2-b]pyridine-3-carbonitrile.
| Compound Name | 5-oxo-2-sulfanylidene-4-thiophen-2-yl-1H-indeno[1,2-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10687171 |
| Molecular Formula | C17H8N2OS2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 5-oxo-2-sulfanylidene-4-thiophen-2-yl-1H-indeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccs2)c2c([nH]c1=S)-c1ccccc1C2=O |
| InChI | InChI=1S/C17H8N2OS2/c18-8-11-13(12-6-3-7-22-12)14-15(19-17(11)21)9-4-1-2-5-10(9)16(14)20/h1-7H,(H,19,21) |
| InChIKey | DXUJVHUYTJQCQB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|