About 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile
5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile (PubChem CID 150365380) has the molecular formula C11H6N2OS3
and a molecular weight of 278.38 g/mol. Its IUPAC name is 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile.
Molecular Properties
| Compound Name | 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile |
| PubChem CID | 150365380 |
| Molecular Formula | C11H6N2OS3 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile |
| SMILES | CS(=O)c1sc(C#N)c(-c2cccs2)c1C#N |
| InChI | InChI=1S/C11H6N2OS3/c1-17(14)11-7(5-12)10(9(6-13)16-11)8-3-2-4-15-8/h2-4H,1H3 |
| InChIKey | GWPAQYHJNQNQEB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile?
The IUPAC name of 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile (CID 150365380) is 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile.
What is the SMILES notation for 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile?
The canonical SMILES for 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile is CS(=O)c1sc(C#N)c(-c2cccs2)c1C#N.
What is the InChIKey of 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile?
The InChIKey is GWPAQYHJNQNQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2OS3/c1-17(14)11-7(5-12)10(9(6-13)16-11)8-3-2-4-15-8/h2-4H,1H3.
What are the key properties of 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile?
5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile has a molecular weight of 278.38 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfinyl-3-thiophen-2-ylthiophene-2,4-dicarbonitrile is sourced from PubChem (CID 150365380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).