C20H22N2OS2 — CID 22305605
(Z)-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 22305605) has the molecular formula C20H22N2OS2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (Z)-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (Z)-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 22305605 |
| Molecular Formula | C20H22N2OS2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (Z)-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CC(C)(C)C1CCc2c(sc(NC(=O)/C=C\c3cccs3)c2C#N)C1 |
| InChI | InChI=1S/C20H22N2OS2/c1-20(2,3)13-6-8-15-16(12-21)19(25-17(15)11-13)22-18(23)9-7-14-5-4-10-24-14/h4-5,7,9-10,13H,6,8,11H2,1-3H3,(H,22,23)/b9-7- |
| InChIKey | BDVLMUCQMISCPS-CLFYSBASSA-N |
| XLogP | 5.48 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|