C21H21N3O3S2 — CID 66944856
[3-cyano-2-(3-thiophen-2-ylprop-2-enoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-methyl-N-prop-2-enylcarbamate (PubChem CID 66944856) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is [3-cyano-2-(3-thiophen-2-ylprop-2-enoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-methyl-N-prop-2-enylcarbamate.
| Compound Name | [3-cyano-2-(3-thiophen-2-ylprop-2-enoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-methyl-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 66944856 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [3-cyano-2-(3-thiophen-2-ylprop-2-enoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-methyl-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C)C(=O)OC1CCc2c(sc(NC(=O)C=Cc3cccs3)c2C#N)C1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-3-10-24(2)21(26)27-14-6-8-16-17(13-22)20(29-18(16)12-14)23-19(25)9-7-15-5-4-11-28-15/h3-5,7,9,11,14H,1,6,8,10,12H2,2H3,(H,23,25) |
| InChIKey | WBGSPZQLEJBNQB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|