C13H13ClN2O2 — CID 87940843
(3aS,6aS)-4-(6-chloro-3-pyridinyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 87940843) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is (3aS,6aS)-4-(6-chloro-3-pyridinyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3aS,6aS)-4-(6-chloro-3-pyridinyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 87940843 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (3aS,6aS)-4-(6-chloro-3-pyridinyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)N1C[C@H]2CC=C(c3ccc(Cl)nc3)[C@H]2C1 |
| InChI | InChI=1S/C13H13ClN2O2/c14-12-4-2-8(5-15-12)10-3-1-9-6-16(13(17)18)7-11(9)10/h2-5,9,11H,1,6-7H2,(H,17,18)/t9-,11+/m1/s1 |
| InChIKey | KPKAFSIMKPWYRD-KOLCDFICSA-N |
| XLogP | 2.75 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|