C14H11ClN2O4 — CID 88503999
5-(6-chloro-3-pyridinyl)-2,3-dihydro-1H-pyrrolizine-2,6-dicarboxylic acid (PubChem CID 88503999) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.70 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-2,3-dihydro-1H-pyrrolizine-2,6-dicarboxylic acid.
| Compound Name | 5-(6-chloro-3-pyridinyl)-2,3-dihydro-1H-pyrrolizine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 88503999 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-2,3-dihydro-1H-pyrrolizine-2,6-dicarboxylic acid |
| SMILES | O=C(O)c1cc2n(c1-c1ccc(Cl)nc1)CC(C(=O)O)C2 |
| InChI | InChI=1S/C14H11ClN2O4/c15-11-2-1-7(5-16-11)12-10(14(20)21)4-9-3-8(13(18)19)6-17(9)12/h1-2,4-5,8H,3,6H2,(H,18,19)(H,20,21) |
| InChIKey | IDUOKNSQGBIXJK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|