C12H8ClNO3 — CID 53222587
2-chloro-5-(4-hydroxyphenyl)pyridine-3-carboxylic acid (PubChem CID 53222587) has the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. Its IUPAC name is 2-chloro-5-(4-hydroxyphenyl)pyridine-3-carboxylic acid.
| Compound Name | 2-chloro-5-(4-hydroxyphenyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53222587 |
| Molecular Formula | C12H8ClNO3 |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-chloro-5-(4-hydroxyphenyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(O)cc2)cnc1Cl |
| InChI | InChI=1S/C12H8ClNO3/c13-11-10(12(16)17)5-8(6-14-11)7-1-3-9(15)4-2-7/h1-6,15H,(H,16,17) |
| InChIKey | NOIBRNDVJJYGQP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|