C18H12Cl3N3O3 — CID 11846213
2-chloro-5-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]phenyl]pyridine-3-carboxylic acid (PubChem CID 11846213) has the molecular formula C18H12Cl3N3O3 and a molecular weight of 424.67 g/mol. Its IUPAC name is 2-chloro-5-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]phenyl]pyridine-3-carboxylic acid.
| Compound Name | 2-chloro-5-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11846213 |
| Molecular Formula | C18H12Cl3N3O3 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | 2-chloro-5-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]phenyl]pyridine-3-carboxylic acid |
| SMILES | Cc1[nH]c(C(=O)Nc2ccc(-c3cnc(Cl)c(C(=O)O)c3)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C18H12Cl3N3O3/c1-8-13(19)14(20)15(23-8)17(25)24-11-4-2-9(3-5-11)10-6-12(18(26)27)16(21)22-7-10/h2-7,23H,1H3,(H,24,25)(H,26,27) |
| InChIKey | QSZZZZFNZUZBRA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|