C21H20Cl2N4O4 — CID 11846380
5-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]phenyl]-2-(2-methoxyethylamino)pyridine-3-carboxylic acid (PubChem CID 11846380) has the molecular formula C21H20Cl2N4O4 and a molecular weight of 463.32 g/mol. Its IUPAC name is 5-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]phenyl]-2-(2-methoxyethylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]phenyl]-2-(2-methoxyethylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11846380 |
| Molecular Formula | C21H20Cl2N4O4 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 5-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]phenyl]-2-(2-methoxyethylamino)pyridine-3-carboxylic acid |
| SMILES | COCCNc1ncc(-c2ccc(NC(=O)c3[nH]c(C)c(Cl)c3Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C21H20Cl2N4O4/c1-11-16(22)17(23)18(26-11)20(28)27-14-5-3-12(4-6-14)13-9-15(21(29)30)19(25-10-13)24-7-8-31-2/h3-6,9-10,26H,7-8H2,1-2H3,(H,24,25)(H,27,28)(H,29,30) |
| InChIKey | OVVUMUXXPLBSAE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|