C13H18Cl2N2O — CID 57485752
3-(6-methoxy-3-pyridinyl)-6-azabicyclo[3.2.1]oct-3-ene;dihydrochloride (PubChem CID 57485752) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 3-(6-methoxy-3-pyridinyl)-6-azabicyclo[3.2.1]oct-3-ene;dihydrochloride.
| Compound Name | 3-(6-methoxy-3-pyridinyl)-6-azabicyclo[3.2.1]oct-3-ene;dihydrochloride |
|---|---|
| PubChem CID | 57485752 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-(6-methoxy-3-pyridinyl)-6-azabicyclo[3.2.1]oct-3-ene;dihydrochloride |
| SMILES | COc1ccc(C2=CC3CC(CN3)C2)cn1.Cl.Cl |
| InChI | InChI=1S/C13H16N2O.2ClH/c1-16-13-3-2-10(8-15-13)11-4-9-5-12(6-11)14-7-9;;/h2-3,6,8-9,12,14H,4-5,7H2,1H3;2*1H |
| InChIKey | JOQIHSQYJJHPDY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |