About 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one
4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one (PubChem CID 158057819) has the molecular formula C24H29ClN2O4S
and a molecular weight of 477.03 g/mol. Its IUPAC name is 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one |
| PubChem CID | 158057819 |
| Molecular Formula | C24H29ClN2O4S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one |
| SMILES | CCC1CCN(c2ccc(S(=O)(=O)Cl)cc2)C1=O.CCC1CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H14ClNO3S.C12H15NO/c1-2-9-7-8-14(12(9)15)10-3-5-11(6-4-10)18(13,16)17;1-2-10-8-9-13(12(10)14)11-6-4-3-5-7-11/h3-6,9H,2,7-8H2,1H3;3-7,10H,2,8-9H2,1H3 |
| InChIKey | FKGYGZOCMFPWBI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one?
The IUPAC name of 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one (CID 158057819) is 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one.
What is the SMILES notation for 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one?
The canonical SMILES for 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one is CCC1CCN(c2ccc(S(=O)(=O)Cl)cc2)C1=O.CCC1CCN(c2ccccc2)C1=O.
What is the InChIKey of 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one?
The InChIKey is FKGYGZOCMFPWBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO3S.C12H15NO/c1-2-9-7-8-14(12(9)15)10-3-5-11(6-4-10)18(13,16)17;1-2-10-8-9-13(12(10)14)11-6-4-3-5-7-11/h3-6,9H,2,7-8H2,1H3;3-7,10H,2,8-9H2,1H3.
What are the key properties of 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one?
4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one has a molecular weight of 477.03 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethyl-2-oxopyrrolidin-1-yl)benzenesulfonyl chloride;3-ethyl-1-phenylpyrrolidin-2-one is sourced from PubChem (CID 158057819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).