C16H15ClN2O3S — CID 95255094
2-chloro-N-[(3R)-2-oxo-1-phenylpyrrolidin-3-yl]benzenesulfonamide (PubChem CID 95255094) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is 2-chloro-N-[(3R)-2-oxo-1-phenylpyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[(3R)-2-oxo-1-phenylpyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 95255094 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-chloro-N-[(3R)-2-oxo-1-phenylpyrrolidin-3-yl]benzenesulfonamide |
| SMILES | O=C1[C@H](NS(=O)(=O)c2ccccc2Cl)CCN1c1ccccc1 |
| InChI | InChI=1S/C16H15ClN2O3S/c17-13-8-4-5-9-15(13)23(21,22)18-14-10-11-19(16(14)20)12-6-2-1-3-7-12/h1-9,14,18H,10-11H2/t14-/m1/s1 |
| InChIKey | YNBDYFGYYMCTON-CQSZACIVSA-N |
| XLogP | 2.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |