C18H19ClN2O4S — CID 53166772
1-(2-chlorophenyl)-N-[1-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 53166772) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[1-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-[1-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 53166772 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[1-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | COc1ccc(N2CCC(NS(=O)(=O)Cc3ccccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-25-15-8-6-14(7-9-15)21-11-10-17(18(21)22)20-26(23,24)12-13-4-2-3-5-16(13)19/h2-9,17,20H,10-12H2,1H3 |
| InChIKey | LPNRZYSFPRNHRU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |