C15H14BrN3O2S — CID 158060267
2-(5-bromo-3-ethoxysulfanyloxy-2-pyridinyl)-7-methylimidazo[1,2-a]pyridine (PubChem CID 158060267) has the molecular formula C15H14BrN3O2S and a molecular weight of 380.27 g/mol. Its IUPAC name is 2-(5-bromo-3-ethoxysulfanyloxy-2-pyridinyl)-7-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-(5-bromo-3-ethoxysulfanyloxy-2-pyridinyl)-7-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 158060267 |
| Molecular Formula | C15H14BrN3O2S |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2-(5-bromo-3-ethoxysulfanyloxy-2-pyridinyl)-7-methylimidazo[1,2-a]pyridine |
| SMILES | CCOSOc1cc(Br)cnc1-c1cn2ccc(C)cc2n1 |
| InChI | InChI=1S/C15H14BrN3O2S/c1-3-20-22-21-13-7-11(16)8-17-15(13)12-9-19-5-4-10(2)6-14(19)18-12/h4-9H,3H2,1-2H3 |
| InChIKey | FKOAJCHWSQXVOP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|