C17H12BrF4N3O3S — CID 153456339
2-(5-bromo-3-ethoxysulfanyloxy-2-pyridinyl)-5,5,7,7-tetrafluoro-1-methylfuro[3,4-f]benzimidazole (PubChem CID 153456339) has the molecular formula C17H12BrF4N3O3S and a molecular weight of 494.26 g/mol. Its IUPAC name is 2-(5-bromo-3-ethoxysulfanyloxy-2-pyridinyl)-5,5,7,7-tetrafluoro-1-methylfuro[3,4-f]benzimidazole.
| Compound Name | 2-(5-bromo-3-ethoxysulfanyloxy-2-pyridinyl)-5,5,7,7-tetrafluoro-1-methylfuro[3,4-f]benzimidazole |
|---|---|
| PubChem CID | 153456339 |
| Molecular Formula | C17H12BrF4N3O3S |
| Molecular Weight | 494.26 g/mol |
| Exact Mass | 492.97 |
| IUPAC Name | 2-(5-bromo-3-ethoxysulfanyloxy-2-pyridinyl)-5,5,7,7-tetrafluoro-1-methylfuro[3,4-f]benzimidazole |
| SMILES | CCOSOc1cc(Br)cnc1-c1nc2cc3c(cc2n1C)C(F)(F)OC3(F)F |
| InChI | InChI=1S/C17H12BrF4N3O3S/c1-3-26-29-27-13-4-8(18)7-23-14(13)15-24-11-5-9-10(6-12(11)25(15)2)17(21,22)28-16(9,19)20/h4-7H,3H2,1-2H3 |
| InChIKey | RBTXXNDXDQBERY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.26 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|