C16H10Br2F5N3O — CID 170775648
5,6-dibromo-1-methyl-2-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]benzimidazole (PubChem CID 170775648) has the molecular formula C16H10Br2F5N3O and a molecular weight of 515.07 g/mol. Its IUPAC name is 5,6-dibromo-1-methyl-2-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]benzimidazole.
| Compound Name | 5,6-dibromo-1-methyl-2-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]benzimidazole |
|---|---|
| PubChem CID | 170775648 |
| Molecular Formula | C16H10Br2F5N3O |
| Molecular Weight | 515.07 g/mol |
| Exact Mass | 512.91 |
| IUPAC Name | 5,6-dibromo-1-methyl-2-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]benzimidazole |
| SMILES | Cn1c(-c2ccc(OCC(F)(F)C(F)(F)F)nc2)nc2cc(Br)c(Br)cc21 |
| InChI | InChI=1S/C16H10Br2F5N3O/c1-26-12-5-10(18)9(17)4-11(12)25-14(26)8-2-3-13(24-6-8)27-7-15(19,20)16(21,22)23/h2-6H,7H2,1H3 |
| InChIKey | MMQAIDZOFWAOPL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.07 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|