C14H9F3IN3O — CID 134544078
3-iodo-5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrazolo[1,5-a]pyridine (PubChem CID 134544078) has the molecular formula C14H9F3IN3O and a molecular weight of 419.14 g/mol. Its IUPAC name is 3-iodo-5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrazolo[1,5-a]pyridine.
| Compound Name | 3-iodo-5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 134544078 |
| Molecular Formula | C14H9F3IN3O |
| Molecular Weight | 419.14 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 3-iodo-5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrazolo[1,5-a]pyridine |
| SMILES | FC(F)(F)COc1ccc(-c2ccn3ncc(I)c3c2)cn1 |
| InChI | InChI=1S/C14H9F3IN3O/c15-14(16,17)8-22-13-2-1-10(6-19-13)9-3-4-21-12(5-9)11(18)7-20-21/h1-7H,8H2 |
| InChIKey | FTPUURVVLLBGAQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|