C9H10O3 — CID 15806321
(E)-non-5-en-2,7-diyne-1,4,9-triol (PubChem CID 15806321) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is (E)-non-5-en-2,7-diyne-1,4,9-triol.
| Compound Name | (E)-non-5-en-2,7-diyne-1,4,9-triol |
|---|---|
| PubChem CID | 15806321 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (E)-non-5-en-2,7-diyne-1,4,9-triol |
| SMILES | OCC#C/C=C/C(O)C#CCO |
| InChI | InChI=1S/C9H10O3/c10-7-3-1-2-5-9(12)6-4-8-11/h2,5,9-12H,7-8H2/b5-2+ |
| InChIKey | XDCLRGINQGMGBH-GORDUTHDSA-N |
| XLogP | -1.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|