C13H12O2 — CID 131751993
(3E,11Z)-trideca-3,11-dien-5,7,9-triyne-1,2-diol (PubChem CID 131751993) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is (3E,11Z)-trideca-3,11-dien-5,7,9-triyne-1,2-diol.
| Compound Name | (3E,11Z)-trideca-3,11-dien-5,7,9-triyne-1,2-diol |
|---|---|
| PubChem CID | 131751993 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (3E,11Z)-trideca-3,11-dien-5,7,9-triyne-1,2-diol |
| SMILES | C/C=C\C#CC#CC#C/C=C/C(O)CO |
| InChI | InChI=1S/C13H12O2/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14/h2-3,10-11,13-15H,12H2,1H3/b3-2-,11-10+ |
| InChIKey | GVCJUCQUVWZELI-JSQGHLFOSA-N |
| XLogP | 0.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|