C16H15BrF6N2 — CID 158064528
4-bromo-3-(trifluoromethyl)aniline;4-ethyl-3-(trifluoromethyl)aniline (PubChem CID 158064528) has the molecular formula C16H15BrF6N2 and a molecular weight of 429.20 g/mol. Its IUPAC name is 4-bromo-3-(trifluoromethyl)aniline;4-ethyl-3-(trifluoromethyl)aniline.
| Compound Name | 4-bromo-3-(trifluoromethyl)aniline;4-ethyl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 158064528 |
| Molecular Formula | C16H15BrF6N2 |
| Molecular Weight | 429.20 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 4-bromo-3-(trifluoromethyl)aniline;4-ethyl-3-(trifluoromethyl)aniline |
| SMILES | CCc1ccc(N)cc1C(F)(F)F.Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3N.C7H5BrF3N/c1-2-6-3-4-7(13)5-8(6)9(10,11)12;8-6-2-1-4(12)3-5(6)7(9,10)11/h3-5H,2,13H2,1H3;1-3H,12H2 |
| InChIKey | FLBFEANLTRNETH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.20 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|