C15H20F3N3O — CID 69248046
2-[4-amino-2-(trifluoromethyl)phenyl]-1-(4-ethylpiperazin-1-yl)ethanone (PubChem CID 69248046) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-[4-amino-2-(trifluoromethyl)phenyl]-1-(4-ethylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-amino-2-(trifluoromethyl)phenyl]-1-(4-ethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 69248046 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[4-amino-2-(trifluoromethyl)phenyl]-1-(4-ethylpiperazin-1-yl)ethanone |
| SMILES | CCN1CCN(C(=O)Cc2ccc(N)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20F3N3O/c1-2-20-5-7-21(8-6-20)14(22)9-11-3-4-12(19)10-13(11)15(16,17)18/h3-4,10H,2,5-9,19H2,1H3 |
| InChIKey | YZTDLMPJWMSPBE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|