C18H26F3N3O2 — CID 67241522
(2S)-4-[[4-amino-2-(trifluoromethyl)phenyl]methyl]-2-tert-butyl-2-methylpiperazine-1-carboxylic acid (PubChem CID 67241522) has the molecular formula C18H26F3N3O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is (2S)-4-[[4-amino-2-(trifluoromethyl)phenyl]methyl]-2-tert-butyl-2-methylpiperazine-1-carboxylic acid.
| Compound Name | (2S)-4-[[4-amino-2-(trifluoromethyl)phenyl]methyl]-2-tert-butyl-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67241522 |
| Molecular Formula | C18H26F3N3O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (2S)-4-[[4-amino-2-(trifluoromethyl)phenyl]methyl]-2-tert-butyl-2-methylpiperazine-1-carboxylic acid |
| SMILES | CC(C)(C)[C@@]1(C)CN(Cc2ccc(N)cc2C(F)(F)F)CCN1C(=O)O |
| InChI | InChI=1S/C18H26F3N3O2/c1-16(2,3)17(4)11-23(7-8-24(17)15(25)26)10-12-5-6-13(22)9-14(12)18(19,20)21/h5-6,9H,7-8,10-11,22H2,1-4H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | KSMXYBAPVKLDPP-QGZVFWFLSA-N |
| XLogP | 3.89 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|