C18H29F3N2OSi — CID 90135394
4-[[3-[dimethyl(propan-2-yl)silyl]oxypiperidin-1-yl]methyl]-3-(trifluoromethyl)aniline (PubChem CID 90135394) has the molecular formula C18H29F3N2OSi and a molecular weight of 374.52 g/mol. Its IUPAC name is 4-[[3-[dimethyl(propan-2-yl)silyl]oxypiperidin-1-yl]methyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[[3-[dimethyl(propan-2-yl)silyl]oxypiperidin-1-yl]methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 90135394 |
| Molecular Formula | C18H29F3N2OSi |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-[[3-[dimethyl(propan-2-yl)silyl]oxypiperidin-1-yl]methyl]-3-(trifluoromethyl)aniline |
| SMILES | CC(C)[Si](C)(C)OC1CCCN(Cc2ccc(N)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C18H29F3N2OSi/c1-13(2)25(3,4)24-16-6-5-9-23(12-16)11-14-7-8-15(22)10-17(14)18(19,20)21/h7-8,10,13,16H,5-6,9,11-12,22H2,1-4H3 |
| InChIKey | BNRPYEIVJGVJCO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|