C12H9N3S2 — CID 158064802
2-(2,1,3-benzothiadiazol-5-ylsulfanyl)aniline (PubChem CID 158064802) has the molecular formula C12H9N3S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-ylsulfanyl)aniline.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 158064802 |
| Molecular Formula | C12H9N3S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-ylsulfanyl)aniline |
| SMILES | Nc1ccccc1Sc1ccc2nsnc2c1 |
| InChI | InChI=1S/C12H9N3S2/c13-9-3-1-2-4-12(9)16-8-5-6-10-11(7-8)15-17-14-10/h1-7H,13H2 |
| InChIKey | FLCBFLSBAPNVCI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|