C24H25BBrN9O2 — CID 158065141
5-bromo-3-isocyanopyridin-2-amine;3-isocyanopyridin-2-amine;3-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 158065141) has the molecular formula C24H25BBrN9O2 and a molecular weight of 562.24 g/mol. Its IUPAC name is 5-bromo-3-isocyanopyridin-2-amine;3-isocyanopyridin-2-amine;3-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-isocyanopyridin-2-amine;3-isocyanopyridin-2-amine;3-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 158065141 |
| Molecular Formula | C24H25BBrN9O2 |
| Molecular Weight | 562.24 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 5-bromo-3-isocyanopyridin-2-amine;3-isocyanopyridin-2-amine;3-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | [C-]#[N+]c1cc(B2OC(C)(C)C(C)(C)O2)cnc1N.[C-]#[N+]c1cc(Br)cnc1N.[C-]#[N+]c1cccnc1N |
| InChI | InChI=1S/C12H16BN3O2.C6H4BrN3.C6H5N3/c1-11(2)12(3,4)18-13(17-11)8-6-9(15-5)10(14)16-7-8;1-9-5-2-4(7)3-10-6(5)8;1-8-5-3-2-4-9-6(5)7/h6-7H,1-4H3,(H2,14,16);2-3H,(H2,8,10);2-4H,(H2,7,9) |
| InChIKey | FLDBECGSRDTCMX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 148.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|