C21H35BBrN5O2S — CID 144889226
4-bromopyridin-2-amine;N-(dimethylaminosulfanyl)-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine;ethane (PubChem CID 144889226) has the molecular formula C21H35BBrN5O2S and a molecular weight of 512.33 g/mol. Its IUPAC name is 4-bromopyridin-2-amine;N-(dimethylaminosulfanyl)-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine;ethane.
| Compound Name | 4-bromopyridin-2-amine;N-(dimethylaminosulfanyl)-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine;ethane |
|---|---|
| PubChem CID | 144889226 |
| Molecular Formula | C21H35BBrN5O2S |
| Molecular Weight | 512.33 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 4-bromopyridin-2-amine;N-(dimethylaminosulfanyl)-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine;ethane |
| SMILES | CC.Cc1ncc(B2OC(C)(C)C(C)(C)O2)cc1NSN(C)C.Nc1cc(Br)ccn1 |
| InChI | InChI=1S/C14H24BN3O2S.C5H5BrN2.C2H6/c1-10-12(17-21-18(6)7)8-11(9-16-10)15-19-13(2,3)14(4,5)20-15;6-4-1-2-8-5(7)3-4;1-2/h8-9,17H,1-7H3;1-3H,(H2,7,8);1-2H3 |
| InChIKey | RHSZOVCWFNUYSG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|