C36H47N5O3 — CID 158068429
(4-methylpiperidin-1-yl)-(2-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-yl)methanone;2-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 158068429) has the molecular formula C36H47N5O3 and a molecular weight of 597.80 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-(2-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-yl)methanone;2-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | (4-methylpiperidin-1-yl)-(2-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-yl)methanone;2-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 158068429 |
| Molecular Formula | C36H47N5O3 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.37 |
| IUPAC Name | (4-methylpiperidin-1-yl)-(2-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-yl)methanone;2-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | CC(C)N1CCc2[nH]c3ccc(C(=O)O)cc3c2C1.CC1CCN(C(=O)c2ccc3[nH]c4c(c3c2)CN(C(C)C)CC4)CC1 |
| InChI | InChI=1S/C21H29N3O.C15H18N2O2/c1-14(2)24-11-8-20-18(13-24)17-12-16(4-5-19(17)22-20)21(25)23-9-6-15(3)7-10-23;1-9(2)17-6-5-14-12(8-17)11-7-10(15(18)19)3-4-13(11)16-14/h4-5,12,14-15,22H,6-11,13H2,1-3H3;3-4,7,9,16H,5-6,8H2,1-2H3,(H,18,19) |
| InChIKey | FLNDBGNHCIQMSQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|