About 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone
1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone (PubChem CID 158069465) has the molecular formula C18H22FNO5
and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone.
Molecular Properties
| Compound Name | 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone |
| PubChem CID | 158069465 |
| Molecular Formula | C18H22FNO5 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone |
| SMILES | CC(=O)N1CCCC1.CC(=O)c1ccc(F)o1.CC(=O)c1ccco1 |
| InChI | InChI=1S/C6H5FO2.C6H11NO.C6H6O2/c1-4(8)5-2-3-6(7)9-5;1-6(8)7-4-2-3-5-7;1-5(7)6-3-2-4-8-6/h2-3H,1H3;2-5H2,1H3;2-4H,1H3 |
| InChIKey | FLQMROXAJBZMAK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone?
The IUPAC name of 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone (CID 158069465) is 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone.
What is the SMILES notation for 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone?
The canonical SMILES for 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone is CC(=O)N1CCCC1.CC(=O)c1ccc(F)o1.CC(=O)c1ccco1.
What is the InChIKey of 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone?
The InChIKey is FLQMROXAJBZMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO2.C6H11NO.C6H6O2/c1-4(8)5-2-3-6(7)9-5;1-6(8)7-4-2-3-5-7;1-5(7)6-3-2-4-8-6/h2-3H,1H3;2-5H2,1H3;2-4H,1H3.
What are the key properties of 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone?
1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone has a molecular weight of 351.37 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluorofuran-2-yl)ethanone;1-(furan-2-yl)ethanone;1-pyrrolidin-1-ylethanone is sourced from PubChem (CID 158069465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).