C49H52FN3O2 — CID 158072553
2-[4-[[5-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]pentylamino]methyl]phenyl]-6-fluoro-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 158072553) has the molecular formula C49H52FN3O2 and a molecular weight of 733.97 g/mol. Its IUPAC name is 2-[4-[[5-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]pentylamino]methyl]phenyl]-6-fluoro-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-[[5-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]pentylamino]methyl]phenyl]-6-fluoro-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 158072553 |
| Molecular Formula | C49H52FN3O2 |
| Molecular Weight | 733.97 g/mol |
| Exact Mass | 733.40 |
| IUPAC Name | 2-[4-[[5-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]pentylamino]methyl]phenyl]-6-fluoro-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)CCCCCNCc2ccc(-c3[nH]c4cc(F)cc5c4c3CCCC5=O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C49H52FN3O2/c1-3-42(36-14-7-4-8-15-36)47(37-16-9-5-10-17-37)38-24-26-41(27-25-38)55-31-30-53(2)29-12-6-11-28-51-34-35-20-22-39(23-21-35)49-43-18-13-19-46(54)44-32-40(50)33-45(52-49)48(43)44/h4-5,7-10,14-17,20-27,32-33,51-52H,3,6,11-13,18-19,28-31,34H2,1-2H3/b47-42- |
| InChIKey | PRLAAWIOMGMYDV-INIKMOEQSA-N |
| XLogP | 11.13 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.97 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|