C43H24N4O+2 — CID 158074933
4-fluoranthen-8-yl-12-oxa-6,23-diaza-2,29-diazonianonacyclo[14.13.2.11,7.02,6.013,30.017,22.023,31.024,29.011,32]dotriaconta-2,4,7(32),8,10,13(30),14,16(31),17,19,21,24,26,28-tetradecaene (PubChem CID 158074933) has the molecular formula C43H24N4O+2 and a molecular weight of 612.69 g/mol. Its IUPAC name is 4-fluoranthen-8-yl-12-oxa-6,23-diaza-2,29-diazonianonacyclo[14.13.2.11,7.02,6.013,30.017,22.023,31.024,29.011,32]dotriaconta-2,4,7(32),8,10,13(30),14,16(31),17,19,21,24,26,28-tetradecaene.
| Compound Name | 4-fluoranthen-8-yl-12-oxa-6,23-diaza-2,29-diazonianonacyclo[14.13.2.11,7.02,6.013,30.017,22.023,31.024,29.011,32]dotriaconta-2,4,7(32),8,10,13(30),14,16(31),17,19,21,24,26,28-tetradecaene |
|---|---|
| PubChem CID | 158074933 |
| Molecular Formula | C43H24N4O+2 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 4-fluoranthen-8-yl-12-oxa-6,23-diaza-2,29-diazonianonacyclo[14.13.2.11,7.02,6.013,30.017,22.023,31.024,29.011,32]dotriaconta-2,4,7(32),8,10,13(30),14,16(31),17,19,21,24,26,28-tetradecaene |
| SMILES | c1cc2c3c(c1)-n1cc(-c4ccc5c(c4)-c4cccc6cccc-5c46)c[n+]1C31c3c(ccc4c5ccccc5n(c34)-c3cccc[n+]31)O2 |
| InChI | InChI=1S/C43H24N4O/c1-2-13-34-29(10-1)32-19-20-37-41-42(32)47(34)38-16-3-4-21-44(38)43(41)40-35(14-7-15-36(40)48-37)45-23-27(24-46(43)45)26-17-18-28-30-11-5-8-25-9-6-12-31(39(25)30)33(28)22-26/h1-24H/q+2 |
| InChIKey | QHTTZRAAMCBDMM-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 26.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|