C39H24N4O+2 — CID 157497252
4-(4-phenylphenyl)-23-oxa-6,17-diaza-2,29-diazonianonacyclo[15.12.2.11,18.02,6.07,30.010,31.011,16.024,29.022,32]dotriaconta-2,4,7(30),8,10(31),11,13,15,18(32),19,21,24,26,28-tetradecaene (PubChem CID 157497252) has the molecular formula C39H24N4O+2 and a molecular weight of 564.65 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-23-oxa-6,17-diaza-2,29-diazonianonacyclo[15.12.2.11,18.02,6.07,30.010,31.011,16.024,29.022,32]dotriaconta-2,4,7(30),8,10(31),11,13,15,18(32),19,21,24,26,28-tetradecaene.
| Compound Name | 4-(4-phenylphenyl)-23-oxa-6,17-diaza-2,29-diazonianonacyclo[15.12.2.11,18.02,6.07,30.010,31.011,16.024,29.022,32]dotriaconta-2,4,7(30),8,10(31),11,13,15,18(32),19,21,24,26,28-tetradecaene |
|---|---|
| PubChem CID | 157497252 |
| Molecular Formula | C39H24N4O+2 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 4-(4-phenylphenyl)-23-oxa-6,17-diaza-2,29-diazonianonacyclo[15.12.2.11,18.02,6.07,30.010,31.011,16.024,29.022,32]dotriaconta-2,4,7(30),8,10(31),11,13,15,18(32),19,21,24,26,28-tetradecaene |
| SMILES | c1ccc(-c2ccc(-c3cn4[n+](c3)C35c6c(cccc6-n6c7ccccc7c7ccc-4c3c76)Oc3cccc[n+]35)cc2)cc1 |
| InChI | InChI=1S/C39H24N4O/c1-2-9-25(10-3-1)26-16-18-27(19-17-26)28-23-41-32-21-20-30-29-11-4-5-12-31(29)43-33-13-8-14-34-36(33)39(42(41)24-28,37(32)38(30)43)40-22-7-6-15-35(40)44-34/h1-24H/q+2 |
| InChIKey | FBMGALFOKYOEBL-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 26.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|