C47H42N4O+2 — CID 158129021
12-(3,5-ditert-butylphenyl)-4-(4-phenylphenyl)-18-oxa-6,12-diaza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene (PubChem CID 158129021) has the molecular formula C47H42N4O+2 and a molecular weight of 678.88 g/mol. Its IUPAC name is 12-(3,5-ditert-butylphenyl)-4-(4-phenylphenyl)-18-oxa-6,12-diaza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene.
| Compound Name | 12-(3,5-ditert-butylphenyl)-4-(4-phenylphenyl)-18-oxa-6,12-diaza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene |
|---|---|
| PubChem CID | 158129021 |
| Molecular Formula | C47H42N4O+2 |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | 12-(3,5-ditert-butylphenyl)-4-(4-phenylphenyl)-18-oxa-6,12-diaza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene |
| SMILES | CC(C)(C)c1cc(N2c3cccc4c3C3(c5c2cccc5-n2cc(-c5ccc(-c6ccccc6)cc5)c[n+]23)[n+]2ccccc2O4)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C47H42N4O/c1-45(2,3)35-26-36(46(4,5)6)28-37(27-35)51-39-17-12-16-38-43(39)47(44-40(51)18-13-19-41(44)52-42-20-10-11-25-48(42)47)50-30-34(29-49(38)50)33-23-21-32(22-24-33)31-14-8-7-9-15-31/h7-30H,1-6H3/q+2 |
| InChIKey | CAGLWKZMRUBNTB-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 25.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|