C35H25N3O2+2 — CID 177081139
3,5-dimethyl-4-(4-phenylphenyl)-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene (PubChem CID 177081139) has the molecular formula C35H25N3O2+2 and a molecular weight of 519.60 g/mol. Its IUPAC name is 3,5-dimethyl-4-(4-phenylphenyl)-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene.
| Compound Name | 3,5-dimethyl-4-(4-phenylphenyl)-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene |
|---|---|
| PubChem CID | 177081139 |
| Molecular Formula | C35H25N3O2+2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 3,5-dimethyl-4-(4-phenylphenyl)-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene |
| SMILES | Cc1c(-c2ccc(-c3ccccc3)cc2)c(C)[n+]2n1-c1cccc3c1C21c2c(cccc2Oc2cccc[n+]21)O3 |
| InChI | InChI=1S/C35H25N3O2/c1-22-32(26-19-17-25(18-20-26)24-10-4-3-5-11-24)23(2)38-35-33-27(37(22)38)12-8-13-28(33)39-29-14-9-15-30(34(29)35)40-31-16-6-7-21-36(31)35/h3-21H,1-2H3/q+2 |
| InChIKey | DVFANDDWPCZFEP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 31.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|