C33H23N3O2+2 — CID 158228893
3,5-dimethyl-4-naphthalen-2-yl-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene (PubChem CID 158228893) has the molecular formula C33H23N3O2+2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 3,5-dimethyl-4-naphthalen-2-yl-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene.
| Compound Name | 3,5-dimethyl-4-naphthalen-2-yl-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene |
|---|---|
| PubChem CID | 158228893 |
| Molecular Formula | C33H23N3O2+2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 3,5-dimethyl-4-naphthalen-2-yl-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13(25),14,16,19,21,23-undecaene |
| SMILES | Cc1c(-c2ccc3ccccc3c2)c(C)[n+]2n1-c1cccc3c1C21c2c(cccc2Oc2cccc[n+]21)O3 |
| InChI | InChI=1S/C33H23N3O2/c1-20-30(24-17-16-22-9-3-4-10-23(22)19-24)21(2)36-33-31-25(35(20)36)11-7-12-26(31)37-27-13-8-14-28(32(27)33)38-29-15-5-6-18-34(29)33/h3-19H,1-2H3/q+2 |
| InChIKey | BAYXIFNJQURKAC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 31.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|