C33H21N3O2+2 — CID 157269003
8-(4-phenylphenyl)-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7,9,11(26),13(25),14,16,19,21,23-undecaene (PubChem CID 157269003) has the molecular formula C33H21N3O2+2 and a molecular weight of 491.55 g/mol. Its IUPAC name is 8-(4-phenylphenyl)-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7,9,11(26),13(25),14,16,19,21,23-undecaene.
| Compound Name | 8-(4-phenylphenyl)-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7,9,11(26),13(25),14,16,19,21,23-undecaene |
|---|---|
| PubChem CID | 157269003 |
| Molecular Formula | C33H21N3O2+2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 8-(4-phenylphenyl)-12,18-dioxa-6-aza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7,9,11(26),13(25),14,16,19,21,23-undecaene |
| SMILES | c1ccc(-c2ccc(-c3ccc4c5c3-n3ccc[n+]3C53c5c(cccc5Oc5cccc[n+]53)O4)cc2)cc1 |
| InChI | InChI=1S/C33H21N3O2/c1-2-8-22(9-3-1)23-13-15-24(16-14-23)25-17-18-28-31-32(25)35-20-7-21-36(35)33(31)30-26(37-28)10-6-11-27(30)38-29-12-4-5-19-34(29)33/h1-21H/q+2 |
| InChIKey | PRDABGLKRKAIOM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 31.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|