C27H15N3O2+2 — CID 158109470
19,25-dioxa-4-aza-5,31-diazonianonacyclo[18.11.1.01,5.02,18.03,15.04,8.09,14.024,32.026,31]dotriaconta-2(18),3(15),5,7,9,11,13,16,20(32),21,23,26,28,30-tetradecaene (PubChem CID 158109470) has the molecular formula C27H15N3O2+2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 19,25-dioxa-4-aza-5,31-diazonianonacyclo[18.11.1.01,5.02,18.03,15.04,8.09,14.024,32.026,31]dotriaconta-2(18),3(15),5,7,9,11,13,16,20(32),21,23,26,28,30-tetradecaene.
| Compound Name | 19,25-dioxa-4-aza-5,31-diazonianonacyclo[18.11.1.01,5.02,18.03,15.04,8.09,14.024,32.026,31]dotriaconta-2(18),3(15),5,7,9,11,13,16,20(32),21,23,26,28,30-tetradecaene |
|---|---|
| PubChem CID | 158109470 |
| Molecular Formula | C27H15N3O2+2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 19,25-dioxa-4-aza-5,31-diazonianonacyclo[18.11.1.01,5.02,18.03,15.04,8.09,14.024,32.026,31]dotriaconta-2(18),3(15),5,7,9,11,13,16,20(32),21,23,26,28,30-tetradecaene |
| SMILES | c1cc2c3c(c1)Oc1cccc[n+]1C31c3c(ccc4c5ccccc5c5cc[n+]1n5c34)O2 |
| InChI | InChI=1S/C27H15N3O2/c1-2-7-17-16(6-1)18-11-12-22-25-26(18)30-19(17)13-15-29(30)27(25)24-20(31-22)8-5-9-21(24)32-23-10-3-4-14-28(23)27/h1-15H/q+2 |
| InChIKey | ZAAOUWVOEYDJDU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|