C35H25N3O+2 — CID 160884362
14-(2,6-dimethyl-4-phenylphenyl)-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13,15,17(24),18,20,22-undecaene (PubChem CID 160884362) has the molecular formula C35H25N3O+2 and a molecular weight of 503.61 g/mol. Its IUPAC name is 14-(2,6-dimethyl-4-phenylphenyl)-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13,15,17(24),18,20,22-undecaene.
| Compound Name | 14-(2,6-dimethyl-4-phenylphenyl)-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13,15,17(24),18,20,22-undecaene |
|---|---|
| PubChem CID | 160884362 |
| Molecular Formula | C35H25N3O+2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 14-(2,6-dimethyl-4-phenylphenyl)-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13,15,17(24),18,20,22-undecaene |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1-c1ccc2c3c1Oc1cccc4c1C3([n+]1ccccc1-2)[n+]1cccn1-4 |
| InChI | InChI=1S/C35H25N3O/c1-22-20-25(24-10-4-3-5-11-24)21-23(2)31(22)27-16-15-26-28-12-6-7-17-36(28)35-32(26)34(27)39-30-14-8-13-29(33(30)35)37-18-9-19-38(35)37/h3-21H,1-2H3/q+2 |
| InChIKey | JHJCUKIFWZBYJK-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 21.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|