C33H20N4O+2 — CID 158851457
19-oxa-1,13-diaza-7,9-diazoniadecacyclo[18.15.2.18,14.02,7.08,37.09,13.023,36.024,29.030,35.018,38]octatriaconta-2,4,6,9,11,14(38),15,17,20(37),21,23(36),24,26,28,30,32,34-heptadecaene (PubChem CID 158851457) has the molecular formula C33H20N4O+2 and a molecular weight of 488.55 g/mol. Its IUPAC name is 19-oxa-1,13-diaza-7,9-diazoniadecacyclo[18.15.2.18,14.02,7.08,37.09,13.023,36.024,29.030,35.018,38]octatriaconta-2,4,6,9,11,14(38),15,17,20(37),21,23(36),24,26,28,30,32,34-heptadecaene.
| Compound Name | 19-oxa-1,13-diaza-7,9-diazoniadecacyclo[18.15.2.18,14.02,7.08,37.09,13.023,36.024,29.030,35.018,38]octatriaconta-2,4,6,9,11,14(38),15,17,20(37),21,23(36),24,26,28,30,32,34-heptadecaene |
|---|---|
| PubChem CID | 158851457 |
| Molecular Formula | C33H20N4O+2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 19-oxa-1,13-diaza-7,9-diazoniadecacyclo[18.15.2.18,14.02,7.08,37.09,13.023,36.024,29.030,35.018,38]octatriaconta-2,4,6,9,11,14(38),15,17,20(37),21,23(36),24,26,28,30,32,34-heptadecaene |
| SMILES | c1ccc2c(c1)-c1ccccc1N1c3c-2ccc2c3C3(c4c(cccc4-n4ccc[n+]43)O2)[n+]2ccccc21 |
| InChI | InChI=1S/C33H20N4O/c1-2-10-22-21(9-1)23-11-3-4-12-25(23)37-29-15-5-6-18-34(29)33-30-26(35-19-8-20-36(33)35)13-7-14-27(30)38-28-17-16-24(22)32(37)31(28)33/h1-20H/q+2 |
| InChIKey | HRXZBQOXVPIUMK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 25.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|