C39H26N4O+2 — CID 159296851
18-phenyl-4-(4-phenylphenyl)-12-oxa-6,18-diaza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13,15,17(25),19,21,23-undecaene (PubChem CID 159296851) has the molecular formula C39H26N4O+2 and a molecular weight of 566.66 g/mol. Its IUPAC name is 18-phenyl-4-(4-phenylphenyl)-12-oxa-6,18-diaza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13,15,17(25),19,21,23-undecaene.
| Compound Name | 18-phenyl-4-(4-phenylphenyl)-12-oxa-6,18-diaza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13,15,17(25),19,21,23-undecaene |
|---|---|
| PubChem CID | 159296851 |
| Molecular Formula | C39H26N4O+2 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 18-phenyl-4-(4-phenylphenyl)-12-oxa-6,18-diaza-2,24-diazoniaheptacyclo[11.11.1.11,7.02,6.017,25.019,24.011,26]hexacosa-2,4,7(26),8,10,13,15,17(25),19,21,23-undecaene |
| SMILES | c1ccc(-c2ccc(-c3cn4[n+](c3)C35c6c(cccc6N(c6ccccc6)c6cccc[n+]63)Oc3cccc-4c35)cc2)cc1 |
| InChI | InChI=1S/C39H26N4O/c1-3-11-27(12-4-1)28-20-22-29(23-21-28)30-25-41-32-15-9-17-34-37(32)39(42(41)26-30)38-33(16-10-18-35(38)44-34)43(31-13-5-2-6-14-31)36-19-7-8-24-40(36)39/h1-26H/q+2 |
| InChIKey | JKLQACDKOHIBTR-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 25.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|