C33H24N4O+2 — CID 158129019
3,5-dimethyl-20-(3-phenylphenyl)-12-oxa-6,18-diaza-2,22-diazoniaheptacyclo[11.9.1.11,7.02,6.017,23.018,22.011,24]tetracosa-2,4,7(24),8,10,13,15,17(23),19,21-decaene (PubChem CID 158129019) has the molecular formula C33H24N4O+2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 3,5-dimethyl-20-(3-phenylphenyl)-12-oxa-6,18-diaza-2,22-diazoniaheptacyclo[11.9.1.11,7.02,6.017,23.018,22.011,24]tetracosa-2,4,7(24),8,10,13,15,17(23),19,21-decaene.
| Compound Name | 3,5-dimethyl-20-(3-phenylphenyl)-12-oxa-6,18-diaza-2,22-diazoniaheptacyclo[11.9.1.11,7.02,6.017,23.018,22.011,24]tetracosa-2,4,7(24),8,10,13,15,17(23),19,21-decaene |
|---|---|
| PubChem CID | 158129019 |
| Molecular Formula | C33H24N4O+2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 3,5-dimethyl-20-(3-phenylphenyl)-12-oxa-6,18-diaza-2,22-diazoniaheptacyclo[11.9.1.11,7.02,6.017,23.018,22.011,24]tetracosa-2,4,7(24),8,10,13,15,17(23),19,21-decaene |
| SMILES | Cc1cc(C)[n+]2n1-c1cccc3c1C21c2c(cccc2-n2cc(-c4cccc(-c5ccccc5)c4)c[n+]21)O3 |
| InChI | InChI=1S/C33H24N4O/c1-21-17-22(2)37-33-31-27(13-7-15-29(31)38-30-16-8-14-28(32(30)33)36(21)37)34-19-26(20-35(33)34)25-12-6-11-24(18-25)23-9-4-3-5-10-23/h3-20H,1-2H3/q+2 |
| InChIKey | YTPRVWBSBHFXOT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|