C34H23N3O+2 — CID 158083057
15-methyl-14,16-diphenyl-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13,15,17(24),18,20,22-undecaene (PubChem CID 158083057) has the molecular formula C34H23N3O+2 and a molecular weight of 489.58 g/mol. Its IUPAC name is 15-methyl-14,16-diphenyl-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13,15,17(24),18,20,22-undecaene.
| Compound Name | 15-methyl-14,16-diphenyl-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13,15,17(24),18,20,22-undecaene |
|---|---|
| PubChem CID | 158083057 |
| Molecular Formula | C34H23N3O+2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 15-methyl-14,16-diphenyl-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13,15,17(24),18,20,22-undecaene |
| SMILES | Cc1c(-c2ccccc2)c2c3c(c1-c1ccccc1)-c1cccc[n+]1C31c3c(cccc3-n3ccc[n+]31)O2 |
| InChI | InChI=1S/C34H23N3O/c1-22-28(23-12-4-2-5-13-23)30-25-16-8-9-19-35(25)34-31-26(36-20-11-21-37(34)36)17-10-18-27(31)38-33(32(30)34)29(22)24-14-6-3-7-15-24/h2-21H,1H3/q+2 |
| InChIKey | YWRSQSUBTCPVQQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 21.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|