C40H27N3O+2 — CID 158784634
20-methyl-16-phenyl-19-(4-phenylphenyl)-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13(24),14,16,18(23),19,21-undecaene (PubChem CID 158784634) has the molecular formula C40H27N3O+2 and a molecular weight of 565.68 g/mol. Its IUPAC name is 20-methyl-16-phenyl-19-(4-phenylphenyl)-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13(24),14,16,18(23),19,21-undecaene.
| Compound Name | 20-methyl-16-phenyl-19-(4-phenylphenyl)-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13(24),14,16,18(23),19,21-undecaene |
|---|---|
| PubChem CID | 158784634 |
| Molecular Formula | C40H27N3O+2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 20-methyl-16-phenyl-19-(4-phenylphenyl)-12-oxa-6-aza-2,23-diazoniaheptacyclo[11.10.1.11,7.02,6.017,24.018,23.011,25]pentacosa-2,4,7(25),8,10,13(24),14,16,18(23),19,21-undecaene |
| SMILES | Cc1cc[n+]2c(c1-c1ccc(-c3ccccc3)cc1)-c1c(-c3ccccc3)ccc3c1C21c2c(cccc2-n2ccc[n+]21)O3 |
| InChI | InChI=1S/C40H27N3O/c1-26-22-25-41-39(35(26)30-18-16-28(17-19-30)27-10-4-2-5-11-27)36-31(29-12-6-3-7-13-29)20-21-34-38(36)40(41)37-32(14-8-15-33(37)44-34)42-23-9-24-43(40)42/h2-25H,1H3/q+2 |
| InChIKey | VRLKJUORJHNATD-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 21.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|