C38H47Br2ClN8O8 — CID 158075127
6-bromo-4-chloro-3-nitroquinoline;tert-butyl (3R)-3-aminopiperidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 158075127) has the molecular formula C38H47Br2ClN8O8 and a molecular weight of 939.10 g/mol. Its IUPAC name is 6-bromo-4-chloro-3-nitroquinoline;tert-butyl (3R)-3-aminopiperidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | 6-bromo-4-chloro-3-nitroquinoline;tert-butyl (3R)-3-aminopiperidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 158075127 |
| Molecular Formula | C38H47Br2ClN8O8 |
| Molecular Weight | 939.10 g/mol |
| Exact Mass | 936.16 |
| IUPAC Name | 6-bromo-4-chloro-3-nitroquinoline;tert-butyl (3R)-3-aminopiperidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](N)C1.CC(C)(C)OC(=O)N1CCC[C@@H](Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)C1.O=[N+]([O-])c1cnc2ccc(Br)cc2c1Cl |
| InChI | InChI=1S/C19H23BrN4O4.C10H20N2O2.C9H4BrClN2O2/c1-19(2,3)28-18(25)23-8-4-5-13(11-23)22-17-14-9-12(20)6-7-15(14)21-10-16(17)24(26)27;1-10(2,3)14-9(13)12-6-4-5-8(11)7-12;10-5-1-2-7-6(3-5)9(11)8(4-12-7)13(14)15/h6-7,9-10,13H,4-5,8,11H2,1-3H3,(H,21,22);8H,4-7,11H2,1-3H3;1-4H/t13-;8-;/m11./s1 |
| InChIKey | FMGVJKAPLXCVET-HRZNLOCRSA-N |
| XLogP | 9.62 |
| TPSA | 209.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.10 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|