C18H20BrFN4O4 — CID 178069514
tert-butyl (3S,4R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 178069514) has the molecular formula C18H20BrFN4O4 and a molecular weight of 455.28 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178069514 |
| Molecular Formula | C18H20BrFN4O4 |
| Molecular Weight | 455.28 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | tert-butyl (3S,4R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)[C@@H](Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)C1 |
| InChI | InChI=1S/C18H20BrFN4O4/c1-18(2,3)28-17(25)23-8-12(20)14(9-23)22-16-11-6-10(19)4-5-13(11)21-7-15(16)24(26)27/h4-7,12,14H,8-9H2,1-3H3,(H,21,22)/t12-,14+/m1/s1 |
| InChIKey | YEHKIZNZRRUMPP-OCCSQVGLSA-N |
| XLogP | 4.27 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|